![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
 |
Parent Directory |
|
- |
|
 |
4LYN |
20-Apr-2018 16:20 |
- |
|
 |
Abyssic Hate |
20-Apr-2018 16:20 |
- |
|
 |
Accomplice Affair |
20-Apr-2018 16:20 |
- |
|
 |
Adaro |
20-Apr-2018 16:20 |
- |
|
 |
Adolphe Adam, Offenbach, Strauss; Antal Doráti, Anatole Fistoulari |
20-Apr-2018 16:20 |
- |
|
 |
Alexander Agricola |
20-Apr-2018 16:20 |
- |
|
 |
AlgorithmDekonstruct |
20-Apr-2018 16:20 |
- |
|
 |
Alicia Keys |
20-Apr-2018 16:20 |
- |
|
 |
Alunni del Sole |
20-Apr-2018 16:20 |
- |
|
 |
Ana Mardare |
20-Apr-2018 16:20 |
- |
|
 |
Andrea Quartarone |
20-Apr-2018 16:20 |
- |
|
 |
Apink |
20-Apr-2018 16:20 |
- |
|
 |
Ari Shaffir |
20-Apr-2018 16:20 |
- |
|
 |
Armin van Buuren pres. Alibi |
20-Apr-2018 16:20 |
- |
|
 |
Ballpen |
20-Apr-2018 16:20 |
- |
|
 |
Bebeto |
20-Apr-2018 16:20 |
- |
|
 |
Beethoven, Debussy; Arturo Benedetti Michelangeli |
20-Apr-2018 16:20 |
- |
|
 |
Benn Jordan |
20-Apr-2018 16:20 |
- |
|
 |
Bertan |
20-Apr-2018 16:20 |
- |
|
 |
Billy ‘Daniel’ Bunter + Rob Vanden |
20-Apr-2018 16:20 |
- |
|
 |
Black Star |
20-Apr-2018 16:20 |
- |
|
 |
Black Tomb |
20-Apr-2018 16:20 |
- |
|
 |
Blind Mice |
20-Apr-2018 16:20 |
- |
|
 |
Blumentopf |
20-Apr-2018 16:20 |
- |
|
 |
Borghesia |
20-Apr-2018 16:20 |
- |
|
 |
Born Sirvibers |
20-Apr-2018 16:20 |
- |
|
 |
Brahms; Barry Douglas |
20-Apr-2018 16:20 |
- |
|
 |
Brennan Savage |
20-Apr-2018 16:20 |
- |
|
 |
Bruce Campbell |
20-Apr-2018 16:20 |
- |
|
 |
Bruneaux |
20-Apr-2018 16:20 |
- |
|
 |
Bushman's Revenge |
20-Apr-2018 16:20 |
- |
|
 |
CNN English Express |
20-Apr-2018 16:20 |
- |
|
 |
Carly Rae Jepsen |
20-Apr-2018 16:20 |
- |
|
 |
Chaba Fadela |
20-Apr-2018 16:20 |
- |
|
 |
Champion featuring Alex Machin |
20-Apr-2018 16:20 |
- |
|
 |
Chemical Waves |
20-Apr-2018 16:20 |
- |
|
 |
Chocolate Elephants |
20-Apr-2018 16:20 |
- |
|
 |
Clara Luzia |
20-Apr-2018 16:20 |
- |
|
 |
Claudia Muzio |
20-Apr-2018 16:20 |
- |
|
 |
Click Click & M_Ferri |
20-Apr-2018 16:20 |
- |
|
 |
Criad Crias vs. Lujhboia |
20-Apr-2018 16:20 |
- |
|
 |
Crimson Tusk |
20-Apr-2018 16:20 |
- |
|
 |
Cuartet |
20-Apr-2018 16:20 |
- |
|
 |
DJ Peter G. & The Clubjock |
20-Apr-2018 16:20 |
- |
|
 |
DNAC |
20-Apr-2018 16:20 |
- |
|
 |
DRAH |
20-Apr-2018 16:20 |
- |
|
 |
DeKobe |
20-Apr-2018 16:20 |
- |
|
 |
Desiderii Marginis |
20-Apr-2018 16:20 |
- |
|
 |
Designs |
20-Apr-2018 16:20 |
- |
|
 |
Doe |
20-Apr-2018 16:20 |
- |
|
 |
Don Cherry & Willie Nelson |
20-Apr-2018 16:20 |
- |
|
 |
Dru Muzik |
20-Apr-2018 16:20 |
- |
|
 |
Duilio Sorrenti & Federico Rapagnetta |
20-Apr-2018 16:20 |
- |
|
 |
Dunaj & Iva Bittová |
20-Apr-2018 16:20 |
- |
|
 |
Dungeon Grunge |
20-Apr-2018 16:20 |
- |
|
 |
ELMA + DMAH |
20-Apr-2018 16:20 |
- |
|
 |
Eastern Grip |
20-Apr-2018 16:20 |
- |
|
 |
Echos |
20-Apr-2018 16:20 |
- |
|
 |
Edisyn |
20-Apr-2018 16:20 |
- |
|
 |
Edu Lobo & Chico Buarque |
20-Apr-2018 16:20 |
- |
|
 |
Eearz |
20-Apr-2018 16:20 |
- |
|
 |
El De La Guitarra |
20-Apr-2018 16:20 |
- |
|
 |
ElectroMetal |
20-Apr-2018 16:20 |
- |
|
 |
Elegy |
20-Apr-2018 16:20 |
- |
|
 |
Escarre |
20-Apr-2018 16:20 |
- |
|
 |
Evanton |
20-Apr-2018 16:20 |
- |
|
 |
Exsanguinate |
20-Apr-2018 16:20 |
- |
|
 |
Fergie Frederiksen |
20-Apr-2018 16:20 |
- |
|
 |
Figurelogic |
20-Apr-2018 16:20 |
- |
|
 |
Finnebassen |
20-Apr-2018 16:20 |
- |
|
 |
Firebrat |
20-Apr-2018 16:20 |
- |
|
 |
Frank Yamma |
20-Apr-2018 16:20 |
- |
|
 |
Frey . Beuger ⁄ Duo Contour |
20-Apr-2018 16:20 |
- |
|
 |
Gardens Of God |
20-Apr-2018 16:20 |
- |
|
 |
General Roots |
20-Apr-2018 16:20 |
- |
|
 |
Gilbert Montagné |
20-Apr-2018 16:20 |
- |
|
 |
Glen Velez with Howard Levy |
20-Apr-2018 16:20 |
- |
|
 |
Grand Mother's Funck |
20-Apr-2018 16:20 |
- |
|
 |
Grieg, Schumann; Cécile Ousset |
20-Apr-2018 16:20 |
- |
|
 |
Grieg; Øystein Birkeland, Håvard Gimse |
20-Apr-2018 16:20 |
- |
|
 |
Guereallaz |
20-Apr-2018 16:20 |
- |
|
 |
Gunter Hampel Group |
20-Apr-2018 16:20 |
- |
|
 |
Gurr |
20-Apr-2018 16:20 |
- |
|
 |
HISTORY |
20-Apr-2018 16:20 |
- |
|
 |
Hank Haint |
20-Apr-2018 16:20 |
- |
|
 |
Hantamrata |
20-Apr-2018 16:20 |
- |
|
 |
Harri Georgio |
20-Apr-2018 16:20 |
- |
|
 |
Haszcara |
20-Apr-2018 16:20 |
- |
|
 |
Hate Meditation |
20-Apr-2018 16:20 |
- |
|
 |
Heavy Winged |
20-Apr-2018 16:20 |
- |
|
 |
Helén Eriksen |
20-Apr-2018 16:20 |
- |
|
 |
Holy Blood |
20-Apr-2018 16:20 |
- |
|
 |
Howard Levy's Acoustic Express |
20-Apr-2018 16:20 |
- |
|
 |
I Refuse |
20-Apr-2018 16:20 |
- |
|
 |
IYAMWRITER |
20-Apr-2018 16:20 |
- |
|
 |
Ibn Inglor |
20-Apr-2018 16:20 |
- |
|
 |
Impurfekt |
20-Apr-2018 16:20 |
- |
|
 |
Ironwill |
20-Apr-2018 16:20 |
- |
|
 |
Izhorian |
20-Apr-2018 16:20 |
- |
|
 |
Jabee |
20-Apr-2018 16:20 |
- |
|
 |
Jaime Llano González |
20-Apr-2018 16:20 |
- |
|
 |
Jean-Pierre Mader |
20-Apr-2018 16:20 |
- |
|
 |
Jef Barbara |
20-Apr-2018 16:20 |
- |
|
 |
Jemima Farey |
20-Apr-2018 16:20 |
- |
|
 |
Jester |
20-Apr-2018 16:20 |
- |
|
 |
Jim Bianco |
20-Apr-2018 16:20 |
- |
|
 |
Jim Henderson |
20-Apr-2018 16:20 |
- |
|
 |
Jim Rockford |
20-Apr-2018 16:20 |
- |
|
 |
Johann Sebastian Bach; Nancy Argenta, Sonnerie, Monica Huggett |
20-Apr-2018 16:20 |
- |
|
 |
Johann Strauss II; Wiener Philharmoniker |
20-Apr-2018 16:20 |
- |
|
 |
Johnny Quest the Rebel |
20-Apr-2018 16:20 |
- |
|
 |
Jon Kenzie |
20-Apr-2018 16:20 |
- |
|
 |
Joseph Power |
20-Apr-2018 16:20 |
- |
|
 |
Junior Jack |
20-Apr-2018 16:20 |
- |
|
 |
Junkhouse |
20-Apr-2018 16:20 |
- |
|
 |
Jviden |
20-Apr-2018 16:20 |
- |
|
 |
KINGDØMS |
20-Apr-2018 16:20 |
- |
|
 |
Kahsay |
20-Apr-2018 16:20 |
- |
|
 |
Kaia |
20-Apr-2018 16:20 |
- |
|
 |
Karen Rodriguez |
20-Apr-2018 16:20 |
- |
|
 |
Karthago |
20-Apr-2018 16:20 |
- |
|
 |
Kevin Henkes read by Dan Bittne |
20-Apr-2018 16:20 |
- |
|
 |
Klaus Wunderlich, Hubert Deuringer |
20-Apr-2018 16:20 |
- |
|
 |
Kuzzo Fly & Mistah F.A.B. |
20-Apr-2018 16:20 |
- |
|
 |
Kylver |
20-Apr-2018 16:20 |
- |
|
 |
LADIES’ CODE |
20-Apr-2018 16:20 |
- |
|
 |
La Chanson Noire |
20-Apr-2018 16:20 |
- |
|
 |
Landless |
20-Apr-2018 16:20 |
- |
|
 |
Last in Line |
20-Apr-2018 16:20 |
- |
|
 |
Lenny Kravitz |
20-Apr-2018 16:20 |
- |
|
 |
Lenny Mac Dowell |
20-Apr-2018 16:20 |
- |
|
 |
Leo Anibaldi |
20-Apr-2018 16:20 |
- |
|
 |
Letay |
20-Apr-2018 16:20 |
- |
|
 |
Licence IV |
20-Apr-2018 16:20 |
- |
|
 |
Lili Refrain |
20-Apr-2018 16:20 |
- |
|
 |
Lionel Hampton and His All Stars |
20-Apr-2018 16:20 |
- |
|
 |
Lloyd Alexander Real Estate |
20-Apr-2018 16:20 |
- |
|
 |
Louis Armstrong, Bing Crosby & Rosemary Clooney |
20-Apr-2018 16:20 |
- |
|
 |
Ludmilla feat. MC Pupio & MC Doguinha |
20-Apr-2018 16:20 |
- |
|
 |
MK featuring Alana |
20-Apr-2018 16:20 |
- |
|
 |
Ma$e |
20-Apr-2018 16:20 |
- |
|
 |
Mani Deïz, Néfaste, Ol Zico & Pejmaxx |
20-Apr-2018 16:20 |
- |
|
 |
Mark Dufresne |
20-Apr-2018 16:20 |
- |
|
 |
Mark Reeder |
20-Apr-2018 16:20 |
- |
|
 |
Markus Portenier |
20-Apr-2018 16:20 |
- |
|
 |
Masskontroll |
20-Apr-2018 16:20 |
- |
|
 |
Mecca Normal |
20-Apr-2018 16:20 |
- |
|
 |
Mel & Kim |
20-Apr-2018 16:20 |
- |
|
 |
Michael Feinstein |
20-Apr-2018 16:20 |
- |
|
 |
Mikael Samuelson |
20-Apr-2018 16:20 |
- |
|
 |
Mitch Fatel |
20-Apr-2018 16:20 |
- |
|
 |
Moira Stewart |
20-Apr-2018 16:20 |
- |
|
 |
Monteverdi Choir, Philip Jones Brass Ensemble, John Eliot Gardiner |
20-Apr-2018 16:20 |
- |
|
 |
Moving Targets |
20-Apr-2018 16:20 |
- |
|
 |
Muschikoffer |
20-Apr-2018 16:20 |
- |
|
 |
NAOKI |
20-Apr-2018 16:20 |
- |
|
 |
Naron |
20-Apr-2018 16:20 |
- |
|
 |
Neurosesick |
20-Apr-2018 16:20 |
- |
|
 |
New York's Ensemble for Early Music, Frederick Renz |
20-Apr-2018 16:20 |
- |
|
 |
Nezih Kılıçkını |
20-Apr-2018 16:20 |
- |
|
 |
Nicole Scherzinger feat. 50 Cent |
20-Apr-2018 16:20 |
- |
|
 |
No Cause for Alarm |
20-Apr-2018 16:20 |
- |
|
 |
Paco Ventura |
20-Apr-2018 16:20 |
- |
|
 |
Parry; Erich Gruenberg, Roger Vignoles |
20-Apr-2018 16:20 |
- |
|
 |
Pascal Estève |
20-Apr-2018 16:20 |
- |
|
 |
Pascal Gentner |
20-Apr-2018 16:20 |
- |
|
 |
Paul Baribeau |
20-Apr-2018 16:20 |
- |
|
 |
Paul Hindemith; ensemble incanto |
20-Apr-2018 16:20 |
- |
|
 |
Paulo Coelho gelesen von Sven Görtz |
20-Apr-2018 16:20 |
- |
|
 |
Peter Lauch & die Regenpfeifer |
20-Apr-2018 16:20 |
- |
|
 |
Poison |
20-Apr-2018 16:20 |
- |
|
 |
Polly Cutter |
20-Apr-2018 16:20 |
- |
|
 |
Portastatic |
20-Apr-2018 16:20 |
- |
|
 |
Product of Rage |
20-Apr-2018 16:20 |
- |
|
 |
Puppets of Chaos |
20-Apr-2018 16:20 |
- |
|
 |
Quintorigo |
20-Apr-2018 16:20 |
- |
|
 |
Raggasonic |
20-Apr-2018 16:20 |
- |
|
 |
Raised by Owls |
20-Apr-2018 16:20 |
- |
|
 |
Raptures of Lovers |
20-Apr-2018 16:20 |
- |
|
 |
Rarity |
20-Apr-2018 16:20 |
- |
|
 |
Richard Tauber |
20-Apr-2018 16:20 |
- |
|
 |
Rimsky-Korsakov; Los Angeles Philharmonic, Israel Philharmonic Orchestra, Zubin Mehta |
20-Apr-2018 16:20 |
- |
|
 |
Robert Schumann; Quatuor Modigliani |
20-Apr-2018 16:20 |
- |
|
 |
Rosa Ponselle |
20-Apr-2018 16:20 |
- |
|
 |
Royal Netherlands Grenadier Guards Band, Celebrity Symphony Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Sam Shalabi ⁄ Alan Bishop & Sam Shalabi, Sam Shalabi ⁄ Alvarius B. |
20-Apr-2018 16:20 |
- |
|
 |
Saturn Never Sleeps |
20-Apr-2018 16:20 |
- |
|
 |
Schubert. Liszt; Orchester Wiener Akademie, Martin Haselböck |
20-Apr-2018 16:20 |
- |
|
 |
Seong-Jin Cho |
20-Apr-2018 16:20 |
- |
|
 |
Shana Falana |
20-Apr-2018 16:20 |
- |
|
 |
Shark Dad |
20-Apr-2018 16:20 |
- |
|
 |
Simani |
20-Apr-2018 16:20 |
- |
|
 |
Sleeping Lessons |
20-Apr-2018 16:20 |
- |
|
 |
Snake Rattle Rattle Snake |
20-Apr-2018 16:20 |
- |
|
 |
Sonoluce |
20-Apr-2018 16:20 |
- |
|
 |
Sponjetta Parrish |
20-Apr-2018 16:20 |
- |
|
 |
Stan Getz avec Astrud Gilberto et João Gilberto |
20-Apr-2018 16:20 |
- |
|
 |
Stones & Bones |
20-Apr-2018 16:20 |
- |
|
 |
Stressmatic |
20-Apr-2018 16:20 |
- |
|
 |
Subset |
20-Apr-2018 16:20 |
- |
|
 |
Sweet Toothe |
20-Apr-2018 16:20 |
- |
|
 |
Symphonity |
20-Apr-2018 16:20 |
- |
|
 |
TLC |
20-Apr-2018 16:20 |
- |
|
 |
Tatsh |
20-Apr-2018 16:20 |
- |
|
 |
Terrapin |
20-Apr-2018 16:20 |
- |
|
 |
The Aussie Bush Band |
20-Apr-2018 16:20 |
- |
|
 |
The Bob Seger System |
20-Apr-2018 16:20 |
- |
|
 |
The Brecker Brothers |
20-Apr-2018 16:20 |
- |
|
 |
The Carnaby |
20-Apr-2018 16:20 |
- |
|
 |
The EOS Ensemble; Jonathan Sheffer |
20-Apr-2018 16:20 |
- |
|
 |
The Flintstones |
20-Apr-2018 16:20 |
- |
|
 |
The Foundations |
20-Apr-2018 16:20 |
- |
|
 |
The Highlanders |
20-Apr-2018 16:20 |
- |
|
 |
The Jet Age |
20-Apr-2018 16:20 |
- |
|
 |
The Rope |
20-Apr-2018 16:20 |
- |
|
 |
The Snipers |
20-Apr-2018 16:20 |
- |
|
 |
The Twilight Singers |
20-Apr-2018 16:20 |
- |
|
 |
The Underground |
20-Apr-2018 16:20 |
- |
|
 |
The Virgin Sleep |
20-Apr-2018 16:20 |
- |
|
 |
Theoretics |
20-Apr-2018 16:20 |
- |
|
 |
This Wild Life |
20-Apr-2018 16:20 |
- |
|
 |
Tiller's Folly |
20-Apr-2018 16:20 |
- |
|
 |
Tom Clay |
20-Apr-2018 16:20 |
- |
|
 |
Topp Dogg |
20-Apr-2018 16:20 |
- |
|
 |
Toxic Aeon |
20-Apr-2018 16:20 |
- |
|
 |
Trevor Dandy |
20-Apr-2018 16:20 |
- |
|
 |
Tryo |
20-Apr-2018 16:20 |
- |
|
 |
Tsering Tobgyal |
20-Apr-2018 16:20 |
- |
|
 |
Tutoriel |
20-Apr-2018 16:20 |
- |
|
 |
Typh Barrow |
20-Apr-2018 16:20 |
- |
|
 |
Under Great Lights |
20-Apr-2018 16:20 |
- |
|
 |
VC-118A |
20-Apr-2018 16:20 |
- |
|
 |
Volksgemeinschaft statt Individualismus |
20-Apr-2018 16:20 |
- |
|
 |
Voot Cha Index |
20-Apr-2018 16:20 |
- |
|
 |
Waxahatchee |
20-Apr-2018 16:20 |
- |
|
 |
ZOH |
20-Apr-2018 16:20 |
- |
|
 |
Zella Day |
20-Apr-2018 16:20 |
- |
|
 |
aka Pelican Groove |
20-Apr-2018 16:20 |
- |
|
 |
clammbon |
20-Apr-2018 16:20 |
- |
|
 |
midnight |
20-Apr-2018 16:20 |
- |
|
 |
À Sombra do Cristo Rei |
20-Apr-2018 16:20 |
- |
|
 |
Πέτρος Δουρδουμπάκης |
20-Apr-2018 16:20 |
- |
|
 |
МодеМ |
20-Apr-2018 16:20 |
- |
|
 |
まみれた |
20-Apr-2018 16:20 |
- |
|
 |
テンテンコ |
20-Apr-2018 16:20 |
- |
|
 |
兼岡行男, 近藤浩治, 田中宏和, Akira, Nobuya, Noriko & Tsutomu |
20-Apr-2018 16:20 |
- |
|
 |
坂本裕介 |
20-Apr-2018 16:20 |
- |
|
 |
登坂広臣 |
20-Apr-2018 16:20 |
- |
|
 |
高崎晃 |
20-Apr-2018 16:20 |
- |
|
 |
종현 |
20-Apr-2018 16:20 |
- |
|
|