![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
|---|
 |
Parent Directory |
|
- |
|
 |
4LYN |
20-Apr-2018 16:20 |
- |
|
|
Abyssic Hate |
20-Apr-2018 16:20 |
- |
|
|
Accomplice Affair |
20-Apr-2018 16:20 |
- |
|
|
Adaro |
20-Apr-2018 16:20 |
- |
|
|
Adolphe Adam, Offenbach, Strauss; Antal Doráti, Anatole Fistoulari |
20-Apr-2018 16:20 |
- |
|
|
Alexander Agricola |
20-Apr-2018 16:20 |
- |
|
|
AlgorithmDekonstruct |
20-Apr-2018 16:20 |
- |
|
|
Alicia Keys |
20-Apr-2018 16:20 |
- |
|
|
Alunni del Sole |
20-Apr-2018 16:20 |
- |
|
|
Ana Mardare |
20-Apr-2018 16:20 |
- |
|
|
Andrea Quartarone |
20-Apr-2018 16:20 |
- |
|
|
Apink |
20-Apr-2018 16:20 |
- |
|
|
Ari Shaffir |
20-Apr-2018 16:20 |
- |
|
|
Armin van Buuren pres. Alibi |
20-Apr-2018 16:20 |
- |
|
|
Ballpen |
20-Apr-2018 16:20 |
- |
|
|
Bebeto |
20-Apr-2018 16:20 |
- |
|
|
Beethoven, Debussy; Arturo Benedetti Michelangeli |
20-Apr-2018 16:20 |
- |
|
|
Benn Jordan |
20-Apr-2018 16:20 |
- |
|
|
Bertan |
20-Apr-2018 16:20 |
- |
|
|
Billy ‘Daniel’ Bunter + Rob Vanden |
20-Apr-2018 16:20 |
- |
|
|
Black Star |
20-Apr-2018 16:20 |
- |
|
|
Black Tomb |
20-Apr-2018 16:20 |
- |
|
|
Blind Mice |
20-Apr-2018 16:20 |
- |
|
|
Blumentopf |
20-Apr-2018 16:20 |
- |
|
|
Borghesia |
20-Apr-2018 16:20 |
- |
|
|
Born Sirvibers |
20-Apr-2018 16:20 |
- |
|
|
Brahms; Barry Douglas |
20-Apr-2018 16:20 |
- |
|
|
Brennan Savage |
20-Apr-2018 16:20 |
- |
|
|
Bruce Campbell |
20-Apr-2018 16:20 |
- |
|
|
Bruneaux |
20-Apr-2018 16:20 |
- |
|
|
Bushman's Revenge |
20-Apr-2018 16:20 |
- |
|
|
CNN English Express |
20-Apr-2018 16:20 |
- |
|
|
Carly Rae Jepsen |
20-Apr-2018 16:20 |
- |
|
|
Chaba Fadela |
20-Apr-2018 16:20 |
- |
|
|
Champion featuring Alex Machin |
20-Apr-2018 16:20 |
- |
|
|
Chemical Waves |
20-Apr-2018 16:20 |
- |
|
|
Chocolate Elephants |
20-Apr-2018 16:20 |
- |
|
|
Clara Luzia |
20-Apr-2018 16:20 |
- |
|
|
Claudia Muzio |
20-Apr-2018 16:20 |
- |
|
|
Click Click & M_Ferri |
20-Apr-2018 16:20 |
- |
|
|
Criad Crias vs. Lujhboia |
20-Apr-2018 16:20 |
- |
|
|
Crimson Tusk |
20-Apr-2018 16:20 |
- |
|
|
Cuartet |
20-Apr-2018 16:20 |
- |
|
|
DJ Peter G. & The Clubjock |
20-Apr-2018 16:20 |
- |
|
|
DNAC |
20-Apr-2018 16:20 |
- |
|
|
DRAH |
20-Apr-2018 16:20 |
- |
|
|
DeKobe |
20-Apr-2018 16:20 |
- |
|
|
Desiderii Marginis |
20-Apr-2018 16:20 |
- |
|
|
Designs |
20-Apr-2018 16:20 |
- |
|
|
Doe |
20-Apr-2018 16:20 |
- |
|
|
Don Cherry & Willie Nelson |
20-Apr-2018 16:20 |
- |
|
|
Dru Muzik |
20-Apr-2018 16:20 |
- |
|
|
Duilio Sorrenti & Federico Rapagnetta |
20-Apr-2018 16:20 |
- |
|
|
Dunaj & Iva Bittová |
20-Apr-2018 16:20 |
- |
|
|
Dungeon Grunge |
20-Apr-2018 16:20 |
- |
|
|
ELMA + DMAH |
20-Apr-2018 16:20 |
- |
|
|
Eastern Grip |
20-Apr-2018 16:20 |
- |
|
|
Echos |
20-Apr-2018 16:20 |
- |
|
|
Edisyn |
20-Apr-2018 16:20 |
- |
|
|
Edu Lobo & Chico Buarque |
20-Apr-2018 16:20 |
- |
|
|
Eearz |
20-Apr-2018 16:20 |
- |
|
|
El De La Guitarra |
20-Apr-2018 16:20 |
- |
|
|
ElectroMetal |
20-Apr-2018 16:20 |
- |
|
|
Elegy |
20-Apr-2018 16:20 |
- |
|
|
Escarre |
20-Apr-2018 16:20 |
- |
|
|
Evanton |
20-Apr-2018 16:20 |
- |
|
|
Exsanguinate |
20-Apr-2018 16:20 |
- |
|
|
Fergie Frederiksen |
20-Apr-2018 16:20 |
- |
|
|
Figurelogic |
20-Apr-2018 16:20 |
- |
|
|
Finnebassen |
20-Apr-2018 16:20 |
- |
|
|
Firebrat |
20-Apr-2018 16:20 |
- |
|
|
Frank Yamma |
20-Apr-2018 16:20 |
- |
|
|
Frey . Beuger ⁄ Duo Contour |
20-Apr-2018 16:20 |
- |
|
|
Gardens Of God |
20-Apr-2018 16:20 |
- |
|
|
General Roots |
20-Apr-2018 16:20 |
- |
|
|
Gilbert Montagné |
20-Apr-2018 16:20 |
- |
|
|
Glen Velez with Howard Levy |
20-Apr-2018 16:20 |
- |
|
|
Grand Mother's Funck |
20-Apr-2018 16:20 |
- |
|
|
Grieg, Schumann; Cécile Ousset |
20-Apr-2018 16:20 |
- |
|
|
Grieg; Øystein Birkeland, Håvard Gimse |
20-Apr-2018 16:20 |
- |
|
|
Guereallaz |
20-Apr-2018 16:20 |
- |
|
|
Gunter Hampel Group |
20-Apr-2018 16:20 |
- |
|
|
Gurr |
20-Apr-2018 16:20 |
- |
|
|
HISTORY |
20-Apr-2018 16:20 |
- |
|
|
Hank Haint |
20-Apr-2018 16:20 |
- |
|
|
Hantamrata |
20-Apr-2018 16:20 |
- |
|
|
Harri Georgio |
20-Apr-2018 16:20 |
- |
|
|
Haszcara |
20-Apr-2018 16:20 |
- |
|
|
Hate Meditation |
20-Apr-2018 16:20 |
- |
|
|
Heavy Winged |
20-Apr-2018 16:20 |
- |
|
|
Helén Eriksen |
20-Apr-2018 16:20 |
- |
|
|
Holy Blood |
20-Apr-2018 16:20 |
- |
|
|
Howard Levy's Acoustic Express |
20-Apr-2018 16:20 |
- |
|
|
I Refuse |
20-Apr-2018 16:20 |
- |
|
|
IYAMWRITER |
20-Apr-2018 16:20 |
- |
|
|
Ibn Inglor |
20-Apr-2018 16:20 |
- |
|
|
Impurfekt |
20-Apr-2018 16:20 |
- |
|
|
Ironwill |
20-Apr-2018 16:20 |
- |
|
|
Izhorian |
20-Apr-2018 16:20 |
- |
|
|
Jabee |
20-Apr-2018 16:20 |
- |
|
|
Jaime Llano González |
20-Apr-2018 16:20 |
- |
|
|
Jean-Pierre Mader |
20-Apr-2018 16:20 |
- |
|
|
Jef Barbara |
20-Apr-2018 16:20 |
- |
|
|
Jemima Farey |
20-Apr-2018 16:20 |
- |
|
|
Jester |
20-Apr-2018 16:20 |
- |
|
|
Jim Bianco |
20-Apr-2018 16:20 |
- |
|
|
Jim Henderson |
20-Apr-2018 16:20 |
- |
|
|
Jim Rockford |
20-Apr-2018 16:20 |
- |
|
|
Johann Sebastian Bach; Nancy Argenta, Sonnerie, Monica Huggett |
20-Apr-2018 16:20 |
- |
|
|
Johann Strauss II; Wiener Philharmoniker |
20-Apr-2018 16:20 |
- |
|
|
Johnny Quest the Rebel |
20-Apr-2018 16:20 |
- |
|
|
Jon Kenzie |
20-Apr-2018 16:20 |
- |
|
|
Joseph Power |
20-Apr-2018 16:20 |
- |
|
|
Junior Jack |
20-Apr-2018 16:20 |
- |
|
|
Junkhouse |
20-Apr-2018 16:20 |
- |
|
|
Jviden |
20-Apr-2018 16:20 |
- |
|
|
KINGDØMS |
20-Apr-2018 16:20 |
- |
|
|
Kahsay |
20-Apr-2018 16:20 |
- |
|
|
Kaia |
20-Apr-2018 16:20 |
- |
|
|
Karen Rodriguez |
20-Apr-2018 16:20 |
- |
|
|
Karthago |
20-Apr-2018 16:20 |
- |
|
|
Kevin Henkes read by Dan Bittne |
20-Apr-2018 16:20 |
- |
|
|
Klaus Wunderlich, Hubert Deuringer |
20-Apr-2018 16:20 |
- |
|
|
Kuzzo Fly & Mistah F.A.B. |
20-Apr-2018 16:20 |
- |
|
|
Kylver |
20-Apr-2018 16:20 |
- |
|
|
LADIES’ CODE |
20-Apr-2018 16:20 |
- |
|
|
La Chanson Noire |
20-Apr-2018 16:20 |
- |
|
|
Landless |
20-Apr-2018 16:20 |
- |
|
|
Last in Line |
20-Apr-2018 16:20 |
- |
|
|
Lenny Kravitz |
20-Apr-2018 16:20 |
- |
|
|
Lenny Mac Dowell |
20-Apr-2018 16:20 |
- |
|
|
Leo Anibaldi |
20-Apr-2018 16:20 |
- |
|
|
Letay |
20-Apr-2018 16:20 |
- |
|
|
Licence IV |
20-Apr-2018 16:20 |
- |
|
|
Lili Refrain |
20-Apr-2018 16:20 |
- |
|
|
Lionel Hampton and His All Stars |
20-Apr-2018 16:20 |
- |
|
|
Lloyd Alexander Real Estate |
20-Apr-2018 16:20 |
- |
|
|
Louis Armstrong, Bing Crosby & Rosemary Clooney |
20-Apr-2018 16:20 |
- |
|
|
Ludmilla feat. MC Pupio & MC Doguinha |
20-Apr-2018 16:20 |
- |
|
|
MK featuring Alana |
20-Apr-2018 16:20 |
- |
|
|
Ma$e |
20-Apr-2018 16:20 |
- |
|
|
Mani Deïz, Néfaste, Ol Zico & Pejmaxx |
20-Apr-2018 16:20 |
- |
|
|
Mark Dufresne |
20-Apr-2018 16:20 |
- |
|
|
Mark Reeder |
20-Apr-2018 16:20 |
- |
|
|
Markus Portenier |
20-Apr-2018 16:20 |
- |
|
|
Masskontroll |
20-Apr-2018 16:20 |
- |
|
|
Mecca Normal |
20-Apr-2018 16:20 |
- |
|
|
Mel & Kim |
20-Apr-2018 16:20 |
- |
|
|
Michael Feinstein |
20-Apr-2018 16:20 |
- |
|
|
Mikael Samuelson |
20-Apr-2018 16:20 |
- |
|
|
Mitch Fatel |
20-Apr-2018 16:20 |
- |
|
|
Moira Stewart |
20-Apr-2018 16:20 |
- |
|
|
Monteverdi Choir, Philip Jones Brass Ensemble, John Eliot Gardiner |
20-Apr-2018 16:20 |
- |
|
|
Moving Targets |
20-Apr-2018 16:20 |
- |
|
|
Muschikoffer |
20-Apr-2018 16:20 |
- |
|
|
NAOKI |
20-Apr-2018 16:20 |
- |
|
|
Naron |
20-Apr-2018 16:20 |
- |
|
|
Neurosesick |
20-Apr-2018 16:20 |
- |
|
|
New York's Ensemble for Early Music, Frederick Renz |
20-Apr-2018 16:20 |
- |
|
|
Nezih Kılıçkını |
20-Apr-2018 16:20 |
- |
|
|
Nicole Scherzinger feat. 50 Cent |
20-Apr-2018 16:20 |
- |
|
|
No Cause for Alarm |
20-Apr-2018 16:20 |
- |
|
|
Paco Ventura |
20-Apr-2018 16:20 |
- |
|
|
Parry; Erich Gruenberg, Roger Vignoles |
20-Apr-2018 16:20 |
- |
|
|
Pascal Estève |
20-Apr-2018 16:20 |
- |
|
|
Pascal Gentner |
20-Apr-2018 16:20 |
- |
|
|
Paul Baribeau |
20-Apr-2018 16:20 |
- |
|
|
Paul Hindemith; ensemble incanto |
20-Apr-2018 16:20 |
- |
|
|
Paulo Coelho gelesen von Sven Görtz |
20-Apr-2018 16:20 |
- |
|
|
Peter Lauch & die Regenpfeifer |
20-Apr-2018 16:20 |
- |
|
|
Poison |
20-Apr-2018 16:20 |
- |
|
|
Polly Cutter |
20-Apr-2018 16:20 |
- |
|
|
Portastatic |
20-Apr-2018 16:20 |
- |
|
|
Product of Rage |
20-Apr-2018 16:20 |
- |
|
|
Puppets of Chaos |
20-Apr-2018 16:20 |
- |
|
|
Quintorigo |
20-Apr-2018 16:20 |
- |
|
|
Raggasonic |
20-Apr-2018 16:20 |
- |
|
|
Raised by Owls |
20-Apr-2018 16:20 |
- |
|
|
Raptures of Lovers |
20-Apr-2018 16:20 |
- |
|
|
Rarity |
20-Apr-2018 16:20 |
- |
|
|
Richard Tauber |
20-Apr-2018 16:20 |
- |
|
|
Rimsky-Korsakov; Los Angeles Philharmonic, Israel Philharmonic Orchestra, Zubin Mehta |
20-Apr-2018 16:20 |
- |
|
|
Robert Schumann; Quatuor Modigliani |
20-Apr-2018 16:20 |
- |
|
|
Rosa Ponselle |
20-Apr-2018 16:20 |
- |
|
|
Royal Netherlands Grenadier Guards Band, Celebrity Symphony Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Sam Shalabi ⁄ Alan Bishop & Sam Shalabi, Sam Shalabi ⁄ Alvarius B. |
20-Apr-2018 16:20 |
- |
|
|
Saturn Never Sleeps |
20-Apr-2018 16:20 |
- |
|
|
Schubert. Liszt; Orchester Wiener Akademie, Martin Haselböck |
20-Apr-2018 16:20 |
- |
|
|
Seong-Jin Cho |
20-Apr-2018 16:20 |
- |
|
|
Shana Falana |
20-Apr-2018 16:20 |
- |
|
|
Shark Dad |
20-Apr-2018 16:20 |
- |
|
|
Simani |
20-Apr-2018 16:20 |
- |
|
|
Sleeping Lessons |
20-Apr-2018 16:20 |
- |
|
|
Snake Rattle Rattle Snake |
20-Apr-2018 16:20 |
- |
|
|
Sonoluce |
20-Apr-2018 16:20 |
- |
|
|
Sponjetta Parrish |
20-Apr-2018 16:20 |
- |
|
|
Stan Getz avec Astrud Gilberto et João Gilberto |
20-Apr-2018 16:20 |
- |
|
|
Stones & Bones |
20-Apr-2018 16:20 |
- |
|
|
Stressmatic |
20-Apr-2018 16:20 |
- |
|
|
Subset |
20-Apr-2018 16:20 |
- |
|
|
Sweet Toothe |
20-Apr-2018 16:20 |
- |
|
|
Symphonity |
20-Apr-2018 16:20 |
- |
|
|
TLC |
20-Apr-2018 16:20 |
- |
|
|
Tatsh |
20-Apr-2018 16:20 |
- |
|
|
Terrapin |
20-Apr-2018 16:20 |
- |
|
|
The Aussie Bush Band |
20-Apr-2018 16:20 |
- |
|
|
The Bob Seger System |
20-Apr-2018 16:20 |
- |
|
|
The Brecker Brothers |
20-Apr-2018 16:20 |
- |
|
|
The Carnaby |
20-Apr-2018 16:20 |
- |
|
|
The EOS Ensemble; Jonathan Sheffer |
20-Apr-2018 16:20 |
- |
|
|
The Flintstones |
20-Apr-2018 16:20 |
- |
|
|
The Foundations |
20-Apr-2018 16:20 |
- |
|
|
The Highlanders |
20-Apr-2018 16:20 |
- |
|
|
The Jet Age |
20-Apr-2018 16:20 |
- |
|
|
The Rope |
20-Apr-2018 16:20 |
- |
|
|
The Snipers |
20-Apr-2018 16:20 |
- |
|
|
The Twilight Singers |
20-Apr-2018 16:20 |
- |
|
|
The Underground |
20-Apr-2018 16:20 |
- |
|
|
The Virgin Sleep |
20-Apr-2018 16:20 |
- |
|
|
Theoretics |
20-Apr-2018 16:20 |
- |
|
|
This Wild Life |
20-Apr-2018 16:20 |
- |
|
|
Tiller's Folly |
20-Apr-2018 16:20 |
- |
|
|
Tom Clay |
20-Apr-2018 16:20 |
- |
|
|
Topp Dogg |
20-Apr-2018 16:20 |
- |
|
|
Toxic Aeon |
20-Apr-2018 16:20 |
- |
|
|
Trevor Dandy |
20-Apr-2018 16:20 |
- |
|
|
Tryo |
20-Apr-2018 16:20 |
- |
|
|
Tsering Tobgyal |
20-Apr-2018 16:20 |
- |
|
|
Tutoriel |
20-Apr-2018 16:20 |
- |
|
|
Typh Barrow |
20-Apr-2018 16:20 |
- |
|
|
Under Great Lights |
20-Apr-2018 16:20 |
- |
|
|
VC-118A |
20-Apr-2018 16:20 |
- |
|
|
Volksgemeinschaft statt Individualismus |
20-Apr-2018 16:20 |
- |
|
|
Voot Cha Index |
20-Apr-2018 16:20 |
- |
|
|
Waxahatchee |
20-Apr-2018 16:20 |
- |
|
|
ZOH |
20-Apr-2018 16:20 |
- |
|
|
Zella Day |
20-Apr-2018 16:20 |
- |
|
|
aka Pelican Groove |
20-Apr-2018 16:20 |
- |
|
|
clammbon |
20-Apr-2018 16:20 |
- |
|
|
midnight |
20-Apr-2018 16:20 |
- |
|
|
À Sombra do Cristo Rei |
20-Apr-2018 16:20 |
- |
|
|
Πέτρος Δουρδουμπάκης |
20-Apr-2018 16:20 |
- |
|
|
МодеМ |
20-Apr-2018 16:20 |
- |
|
|
まみれた |
20-Apr-2018 16:20 |
- |
|
|
テンテンコ |
20-Apr-2018 16:20 |
- |
|
|
兼岡行男, 近藤浩治, 田中宏和, Akira, Nobuya, Noriko & Tsutomu |
20-Apr-2018 16:20 |
- |
|
|
坂本裕介 |
20-Apr-2018 16:20 |
- |
|
|
登坂広臣 |
20-Apr-2018 16:20 |
- |
|
|
高崎晃 |
20-Apr-2018 16:20 |
- |
|
|
종현 |
20-Apr-2018 16:20 |
- |
|
|
|---|